cas: 269718-83-4 — see every product listed under this CAS number, including other names
Pardoprunox (hydrochloride), 99.46% (CAS 269718-83-4) is a chemical reagent available from Chemat. Available pack sizes: 10 mg, 5 mg, 10mM/1mL, 50 mg, 100 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-14958A-10 mg |
| cas | 269718-83-4 |
| size | 10 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 mg | 551.89 Pln | |
| MedChemExpress | 5 mg | 384.71 Pln | |
| MedChemExpress | 10mM/1mL | 412.57 Pln | |
| MedChemExpress | 50 mg | 1318.15 Pln | |
| MedChemExpress | 100 mg | 2279.46 Pln | |
| MedChemExpress | 25 mg | 839.82 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.46% |
7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 269718-83-4) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: NQRIKTDKFHAOKC-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | NQRIKTDKFHAOKC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC3=C2OC(=O)N3.Cl |
Computed by PubChem (NCBI)