cas: 269718-83-4 — see every product listed under this CAS number, including other names
Pardoprunox hydrochloride (SLV–308 hydrochloride) (CAS 269718-83-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC30980-10 |
| cas | 269718-83-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 793.62 Pln | |
| GLPBio | 100mg | 2310.10 Pln | |
| GLPBio | 25mg | 1046.37 Pln | |
| GLPBio | 5mg | 648.53 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 671.93 Pln | |
| GLPBio | 50mg | 1467.61 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 269718-83-4) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: NQRIKTDKFHAOKC-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | NQRIKTDKFHAOKC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC3=C2OC(=O)N3.Cl |
Computed by PubChem (NCBI)