cas: 198470-85-8 — see every product listed under this CAS number, including other names
Parecoxib Sodium 98% (CAS 198470-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A141185-1mg |
| cas | 198470-85-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 209.06 Pln | |
| Ambeed | 5mg | 259.12 Pln | |
| Ambeed | 25mg | 298.06 Pln | |
| Ambeed | 50mg | 353.69 Pln | |
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A141185 |
Sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide (CAS 198470-85-8) is a chemical compound with the molecular formula C19H17N2NaO4S and a molecular weight of 392.4 g/mol. IUPAC name: sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide. InChIKey: HQPVVKXJNZEAFW-UHFFFAOYSA-M.
| Molecular formula | C19H17N2NaO4S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide |
| InChIKey | HQPVVKXJNZEAFW-UHFFFAOYSA-M |
| SMILES | CCC(=O)[N-]S(=O)(=O)C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)C.[Na+] |
Computed by PubChem (NCBI)