CAS 198470-85-8 appears in our catalog under these names: Parecoxib Sodium Salt, Parecoxib Sodium, >95% (HPLC), Parecoxib Sodium, Parecoxib Sodium, Parecoxib Sodium, >95.0%(HPLC)(T). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 250mg, 25mg, 10mM (in 1ml dmso), 50mg, 0,5g.
Sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide (CAS 198470-85-8) is a chemical compound with the molecular formula C19H17N2NaO4S and a molecular weight of 392.4 g/mol. IUPAC name: sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide. InChIKey: HQPVVKXJNZEAFW-UHFFFAOYSA-M.
| Molecular formula | C19H17N2NaO4S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | sodium [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl-propanoylazanide |
| InChIKey | HQPVVKXJNZEAFW-UHFFFAOYSA-M |
| SMILES | CCC(=O)[N-]S(=O)(=O)C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)C.[Na+] |
Computed by PubChem (NCBI)