CAS 114568-32-0 appears in our catalog under these names: Patamostat mesylate/ 99.77% (existing batch purity), Patomostat mesilate, Patamostat (mesylate). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
[4-[2-(2,5-dioxopyrrolidin-1-yl)ethylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate;methanesulfonic acid (CAS 114568-32-0) is a chemical compound with the molecular formula C21H24N4O7S2 and a molecular weight of 508.6 g/mol. IUPAC name: [4-[2-(2,5-dioxopyrrolidin-1-yl)ethylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate;methanesulfonic acid. InChIKey: HTSFLDCSCNSKJW-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O7S2 |
|---|---|
| Molecular weight | 508.6 g/mol |
| IUPAC name | [4-[2-(2,5-dioxopyrrolidin-1-yl)ethylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate;methanesulfonic acid |
| InChIKey | HTSFLDCSCNSKJW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CC(=O)N(C1=O)CCSC2=CC=C(C=C2)OC(=O)C3=CC=C(C=C3)N=C(N)N |
Computed by PubChem (NCBI)