cas: 90-65-3 — see every product listed under this CAS number, including other names
Penicillic acid, 99.83% (CAS 90-65-3) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N6777-5 mg |
| cas | 90-65-3 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 839.82 Pln | |
| MedChemExpress | 10 mg | 1318.15 Pln | |
| MedChemExpress | 10mM/1mL | 909.48 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.83% |
(2Z)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid (CAS 90-65-3) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (2Z)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid. InChIKey: VOUGEZYPVGAPBB-XQRVVYSFSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (2Z)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid |
| InChIKey | VOUGEZYPVGAPBB-XQRVVYSFSA-N |
| SMILES | CC(=C)C(=O)/C(=C/C(=O)O)/OC |
Computed by PubChem (NCBI)