CAS 13156-11-1 appears in our catalog under these names: 4,5,5-Trimethyl-2-oxo-2,5-dihydrofuran-3-carboxylic acid, 95%, 4,5,5-Trimethyl-2-oxo-2,5-dihydrofuran-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
4,5,5-trimethyl-2-oxofuran-3-carboxylic acid (CAS 13156-11-1) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 4,5,5-trimethyl-2-oxofuran-3-carboxylic acid. InChIKey: WDBWMWDAYBDTOO-UHFFFAOYSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 4,5,5-trimethyl-2-oxofuran-3-carboxylic acid |
| InChIKey | WDBWMWDAYBDTOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC1(C)C)C(=O)O |
Computed by PubChem (NCBI)