cas: 55303-92-9 — see every product listed under this CAS number, including other names
Penicillide, ≥98%(HPLC), ≥98%(HPLC) (CAS 55303-92-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DGQW-1mg |
| cas | 55303-92-9 |
| size | 1mg |
| availability | 0.002g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 1715.60 Pln |
| purity | ≥98%(HPLC) |
|---|---|
| delivery time | 3 weeks |
6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one (CAS 55303-92-9) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one. InChIKey: UOWGLBYIKHMCIS-UHFFFAOYSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one |
| InChIKey | UOWGLBYIKHMCIS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)C(CC(C)C)O)OC)C(=O)OC2 |
Computed by PubChem (NCBI)