cas: 55303-92-9 — see every product listed under this CAS number, including other names
Penicillide (CAS 55303-92-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 500ug, 500μg, 250ug, 500 μg. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T36931-1mg |
| cas | 55303-92-9 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 3068.79 Pln | |
| TargetMol | 500ug | 1899.92 Pln | |
| GLPBio | 1mg | 1598.67 Pln | |
| GLPBio | 500μg | 1111.89 Pln | |
| Chemat | 1mg | 1223.32 Pln | |
| Chemat | 250ug | 597.85 Pln | |
| MedChemExpress | 500 μg | 1327.44 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one (CAS 55303-92-9) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one. InChIKey: UOWGLBYIKHMCIS-UHFFFAOYSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 6-hydroxy-2-(1-hydroxy-3-methylbutyl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one |
| InChIKey | UOWGLBYIKHMCIS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)C(CC(C)C)O)OC)C(=O)OC2 |
Computed by PubChem (NCBI)