CAS 773-82-0 appears in our catalog under these names: Pentafluorobenzonitrile, 95%, 2,3,4,5,6–Pentafluorobenzonitrile, Pentafluorobenzonitrile/ 98%, Pentafluorobenzonitrile, 98% , Pentafluorobenzonitrile, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 25g, 5g, 500g, 10G, 1g.
2,3,4,5,6-pentafluorobenzonitrile (CAS 773-82-0) is a chemical compound with the molecular formula C7F5N and a molecular weight of 193.07 g/mol. IUPAC name: 2,3,4,5,6-pentafluorobenzonitrile. InChIKey: YXWJGZQOGXGSSC-UHFFFAOYSA-N.
| Molecular formula | C7F5N |
|---|---|
| Molecular weight | 193.07 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluorobenzonitrile |
| InChIKey | YXWJGZQOGXGSSC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)