cas: 402726-78-7 — see every product listed under this CAS number, including other names
Pentanedioic acid, 2-oxo-, calcium salt, hydrate (1:1:1), 98% (contains <7%H2O), 98% (contains <7%H2O) (CAS 402726-78-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WA5X-25g |
| cas | 402726-78-7 |
| size | 25g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 198.80 Pln |
| purity | 98% (contains <7%H2O) |
|---|---|
| delivery time | 3 weeks |
Calcium;2-oxopentanedioate;hydrate (CAS 402726-78-7) is a chemical compound with the molecular formula C5H6CaO6 and a molecular weight of 202.18 g/mol. IUPAC name: calcium;2-oxopentanedioate;hydrate. InChIKey: VWPLIFKKLCVFCQ-UHFFFAOYSA-L.
| Molecular formula | C5H6CaO6 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | calcium;2-oxopentanedioate;hydrate |
| InChIKey | VWPLIFKKLCVFCQ-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].O.[Ca+2] |
Computed by PubChem (NCBI)