CAS 402726-78-7 appears in our catalog under these names: Calcium 2-oxopentanedioate x hydrate, 95%, Alpha-calcium ketoglutarate monohydrate/ 97%, Calcium 2-oxopentanedioate xhydrate, Calcium 2-oxopentanedioate xhydrate 98% (contains <7%H2O), Pentanedioic acid, 2-oxo-, calcium salt, hydrate (1:1:1), 98% (contains <7%H2O), 98% (contains <7%H2O). Offered by: Combi-blocks, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 5mg, 10mg, 25mg, 50mg.
Calcium;2-oxopentanedioate;hydrate (CAS 402726-78-7) is a chemical compound with the molecular formula C5H6CaO6 and a molecular weight of 202.18 g/mol. IUPAC name: calcium;2-oxopentanedioate;hydrate. InChIKey: VWPLIFKKLCVFCQ-UHFFFAOYSA-L.
| Molecular formula | C5H6CaO6 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | calcium;2-oxopentanedioate;hydrate |
| InChIKey | VWPLIFKKLCVFCQ-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].O.[Ca+2] |
Computed by PubChem (NCBI)