cas: 355-43-1 — see every product listed under this CAS number, including other names
Perfluoro-1-iodohexane, 97% (CAS 355-43-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 269940050 |
| cas | 355-43-1 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 154.57 Pln | |
| Thermo Scientific (Acros) | 25g | 433.86 Pln | |
| Thermo Scientific (Acros) | 100g | 1594.69 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane (CAS 355-43-1) is a chemical compound with the molecular formula C6F13I and a molecular weight of 445.95 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane. InChIKey: BULLJMKUVKYZDJ-UHFFFAOYSA-N.
| Molecular formula | C6F13I |
|---|---|
| Molecular weight | 445.95 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane |
| InChIKey | BULLJMKUVKYZDJ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)I)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)