CAS 102780-88-1 is the registry number for Decafluoro-2-trifluoromethyl-2-iodopentane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,1,1,2,2,3,3,5,5,5-decafluoro-4-iodo-4-(trifluoromethyl)pentane (CAS 102780-88-1) is a chemical compound with the molecular formula C6F13I and a molecular weight of 445.95 g/mol. IUPAC name: 1,1,1,2,2,3,3,5,5,5-decafluoro-4-iodo-4-(trifluoromethyl)pentane. InChIKey: PCOHEQOCJXXENZ-UHFFFAOYSA-N.
| Molecular formula | C6F13I |
|---|---|
| Molecular weight | 445.95 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-iodo-4-(trifluoromethyl)pentane |
| InChIKey | PCOHEQOCJXXENZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)I |
Computed by PubChem (NCBI)