CAS 1188094-10-1 is the registry number for Phenanthren-2-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Phenanthren-2-ylboronic acid (CAS 1188094-10-1) is a chemical compound with the molecular formula C14H11BO2 and a molecular weight of 222.05 g/mol. IUPAC name: phenanthren-2-ylboronic acid. InChIKey: MWIZGXJYCNZVDW-UHFFFAOYSA-N.
| Molecular formula | C14H11BO2 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | phenanthren-2-ylboronic acid |
| InChIKey | MWIZGXJYCNZVDW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C=C2)(O)O |
Computed by PubChem (NCBI)