Products 141981-64-8
CAS 141981-64-8 appears in our catalog under these names: 2–Anthraceneboronic Acid(contains varying amounts of Anhydride), 2-Anthraceneboronic Acid (contains varying amounts of Anhydride), Anthracen-2-ylboronic acid 98%, Anthracen-2-ylboronic acid, 98%, 98%, 2-Anthracenylboronic acid (contains varying amounts of anhydride), 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
Anthracen-2-ylboronic acid (CAS 141981-64-8) is a chemical compound with the molecular formula C14H11BO2 and a molecular weight of 222.05 g/mol. IUPAC name: anthracen-2-ylboronic acid. InChIKey: PKWBMOXZIMVOJT-UHFFFAOYSA-N.
| Molecular formula | C14H11BO2 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | anthracen-2-ylboronic acid |
| InChIKey | PKWBMOXZIMVOJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC3=CC=CC=C3C=C2C=C1)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-anthraceneboronic acid (contains varying amounts of anhydride), Anthracen-2-ylboronic Acid, 2-Anthraceneboronic Acid, 2-anthracenylboronic acid, 2-anthrylboronic acid, Boronic acid, B-2-anthracenyl-, 2-Anthraceneboronic Acid, (contains varying amounts of Anhydride), Boronic acid, 2-anthracenyl-, 2-anthracenylboronicacid, Anthracen-2-ylboronicAcid