Products 141981-64-8

CAS 141981-64-8 appears in our catalog under these names: 2–Anthraceneboronic Acid(contains varying amounts of Anhydride), 2-Anthraceneboronic Acid (contains varying amounts of Anhydride), Anthracen-2-ylboronic acid, 98%, 98%, 2-Anthracenylboronic acid (contains varying amounts of anhydride), 98%, Anthracen-2-ylboronic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.

Structural formula: {0} (CAS {1})

Anthracen-2-ylboronic acid (CAS 141981-64-8) is a chemical compound with the molecular formula C14H11BO2 and a molecular weight of 222.05 g/mol. IUPAC name: anthracen-2-ylboronic acid. InChIKey: PKWBMOXZIMVOJT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BO2
Molecular weight222.05 g/mol
IUPAC nameanthracen-2-ylboronic acid
InChIKeyPKWBMOXZIMVOJT-UHFFFAOYSA-N
SMILESB(C1=CC2=CC3=CC=CC=C3C=C2C=C1)(O)O

Computed by PubChem (NCBI)