Products 1188094-46-3

CAS 1188094-46-3 is the registry number for 3-Phenanthreneboronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Phenanthren-3-ylboronic acid (CAS 1188094-46-3) is a chemical compound with the molecular formula C14H11BO2 and a molecular weight of 222.05 g/mol. IUPAC name: phenanthren-3-ylboronic acid. InChIKey: UPYVSYVLGOADDG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BO2
Molecular weight222.05 g/mol
IUPAC namephenanthren-3-ylboronic acid
InChIKeyUPYVSYVLGOADDG-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)C=CC3=CC=CC=C32)(O)O

Computed by PubChem (NCBI)