cas: 960388-56-1 — see every product listed under this CAS number, including other names
Phenol, 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 98%, 98% (CAS 960388-56-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117SRD-100mg |
| cas | 960388-56-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 1g | 486.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 960388-56-1) is a chemical compound with the molecular formula C12H16BClO3 and a molecular weight of 254.52 g/mol. IUPAC name: 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: MJTRKHGZBSKPKX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO3 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | MJTRKHGZBSKPKX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)O |
Computed by PubChem (NCBI)