cas: 1377503-12-2 — see every product listed under this CAS number, including other names
Phenol, 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 97%, 97% (CAS 1377503-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124SH-250mg |
| cas | 1377503-12-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 3165.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1377503-12-2) is a chemical compound with the molecular formula C12H16BClO3 and a molecular weight of 254.52 g/mol. IUPAC name: 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: ABVROALGWBBEGX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO3 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | ABVROALGWBBEGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)