Phenoxydiphenylphosphine, 95%
cas: 13360-92-4 — see every product listed under this CAS number, including other names
Phenoxydiphenylphosphine, 95% (CAS 13360-92-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114TOJ-250mg |
| cas | 13360-92-4 |
| size | 250mg |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 501.20 Pln | |
| Chemat | 100g | 1821.20 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 716.43 Pln | |
| Fluorochem | 100g | 1976.41 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 250mg | 102.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Phenoxy(diphenyl)phosphane (CAS 13360-92-4) is a chemical compound with the molecular formula C18H15OP and a molecular weight of 278.3 g/mol. IUPAC name: phenoxy(diphenyl)phosphane. InChIKey: UPDNYUVJHQABBS-UHFFFAOYSA-N.
| Molecular formula | C18H15OP |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | phenoxy(diphenyl)phosphane |
| InChIKey | UPDNYUVJHQABBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)