CAS 54964-93-1 appears in our catalog under these names: Triphenylphosphine Oxide-d15, Triphenylphosphine Oxide-d15, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
1-bis(2,3,4,5,6-pentadeuteriophenyl)phosphoryl-2,3,4,5,6-pentadeuteriobenzene (CAS 54964-93-1) is a chemical compound with the molecular formula C18H15OP and a molecular weight of 293.4 g/mol. IUPAC name: 1-bis(2,3,4,5,6-pentadeuteriophenyl)phosphoryl-2,3,4,5,6-pentadeuteriobenzene. InChIKey: FIQMHBFVRAXMOP-KLHTYYPYSA-N.
| Molecular formula | C18H15OP |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 1-bis(2,3,4,5,6-pentadeuteriophenyl)phosphoryl-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | FIQMHBFVRAXMOP-KLHTYYPYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])P(=O)(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)