cas: 1256360-12-9 — see every product listed under this CAS number, including other names
Phenyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-1-yl)methanone 95% (CAS 1256360-12-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A684729-100mg |
| cas | 1256360-12-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 5699.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A684729 |
Phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone (CAS 1256360-12-9) is a chemical compound with the molecular formula C17H20BNO3 and a molecular weight of 297.2 g/mol. IUPAC name: phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone. InChIKey: ODVABAFGSMXFEL-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO3 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone |
| InChIKey | ODVABAFGSMXFEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)