cas: 39930-11-5 — see every product listed under this CAS number, including other names
Phenyl(pyridin-2-yl)methanamine, 95% (CAS 39930-11-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093108-1G |
| cas | 39930-11-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Fluorochem | 10g | 1096.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Phenyl(pyridin-2-yl)methanamine (CAS 39930-11-5) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: phenyl(pyridin-2-yl)methanamine. InChIKey: BAEZXIOBOOEPOS-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | phenyl(pyridin-2-yl)methanamine |
| InChIKey | BAEZXIOBOOEPOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=N2)N |
Computed by PubChem (NCBI)