CAS 712-61-8 appears in our catalog under these names: 2,2'-Dimethyl-4,4'-bipyridine, 95%, 2,2'–Dimethyl–4,4'–bipyridine, 2,2'-Dimethyl-4,4'-bipyridine 98%, 2,2'-Dimethyl-4,4'-bipyridine, 98%, 98%, 2,2'-Dimethyl-[4,4']bipyridinyl, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2-methyl-4-(2-methyl-4-pyridinyl)pyridine (CAS 712-61-8) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 2-methyl-4-(2-methyl-4-pyridinyl)pyridine. InChIKey: WSTOEGIEWBZMLU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2-methyl-4-(2-methyl-4-pyridinyl)pyridine |
| InChIKey | WSTOEGIEWBZMLU-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C2=CC(=NC=C2)C |
Computed by PubChem (NCBI)