CAS 51766-21-3 appears in our catalog under these names: Phenyl n-phenylphosphoramidochloridate, 95%, Phenyl-N-phenylphosphoramidochloridate/ 99%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g.
N-[chloro(phenoxy)phosphoryl]aniline (CAS 51766-21-3) is a chemical compound with the molecular formula C12H11ClNO2P and a molecular weight of 267.65 g/mol. IUPAC name: N-[chloro(phenoxy)phosphoryl]aniline. InChIKey: ZUQYQPGYEFBITH-UHFFFAOYSA-N.
| Molecular formula | C12H11ClNO2P |
|---|---|
| Molecular weight | 267.65 g/mol |
| IUPAC name | N-[chloro(phenoxy)phosphoryl]aniline |
| InChIKey | ZUQYQPGYEFBITH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NP(=O)(OC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)