Phillygenin 98%
cas: 487-39-8 — see every product listed under this CAS number, including other names
Phillygenin 98% (CAS 487-39-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A821594-50mg |
| cas | 487-39-8 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 743.06 Pln | |
| Ambeed | 100mg | 1076.81 Pln | |
| Ambeed | 250mg | 1983.50 Pln | |
| Ambeed | 1g | 5220.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A821594 |
4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol (CAS 487-39-8) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol. InChIKey: CPJKKWDCUOOTEW-YJPXFSGGSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChIKey | CPJKKWDCUOOTEW-YJPXFSGGSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)OC |
Computed by PubChem (NCBI)