Products 487-39-8
CAS 487-39-8 appears in our catalog under these names: Phillygenin, 95%, (+)-Sylvatesmin, Phillygenin/ 98.7% (existing batch purity), Phillygenin (Phillygenol), Phillygenin 98%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 1mg, 10mM (in 1ml dmso), 250mg.
4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol (CAS 487-39-8) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol. InChIKey: CPJKKWDCUOOTEW-YJPXFSGGSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 4-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChIKey | CPJKKWDCUOOTEW-YJPXFSGGSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)OC |
Computed by PubChem (NCBI)