cas: 487-36-5 — see every product listed under this CAS number, including other names
Pinoresinol, 95% (CAS 487-36-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 1mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A200331-250mg |
| cas | 487-36-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3969.31 Pln | |
| Ambeed | 1g | 10599.81 Pln | |
| Chemat | 1mg | 150.80 Pln | |
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 25mg | 702.80 Pln | |
| Chemat | 50mg | 1082.00 Pln | |
| Chemat | 100mg | 1696.40 Pln | |
| Chemat | 250mg | 3904.40 Pln | |
| Chemat | 1g | 10442.00 Pln | |
| Fluorochem | 1mg | 247.85 Pln | |
| Fluorochem | 25mg | 1299.56 Pln | |
| Fluorochem | 50mg | 2007.64 Pln | |
| Fluorochem | 100mg | 3163.49 Pln | |
| Fluorochem | 250mg | 7110.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(+)-pinoresinol is an enantiomer of pinoresinol having (+)-1S,3aR,4S,6aR-configuration. It has a role as a hypoglycemic agent, a plant metabolite and a phytoestrogen.
Source: ChEBI
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O |
Computed by PubChem (NCBI)