CAS 871351-61-0 appears in our catalog under these names: Piperidine-MO-1/ 97.37% (existing batch purity), Piperidine–MO–1, Piperidine-MO-1, Ordopidine (hydrochloride). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
1-ethyl-4-(2-fluoro-3-methylsulfonylphenyl)piperidine;hydrochloride (CAS 871351-61-0) is a chemical compound with the molecular formula C14H21ClFNO2S and a molecular weight of 321.8 g/mol. IUPAC name: 1-ethyl-4-(2-fluoro-3-methylsulfonylphenyl)piperidine;hydrochloride. InChIKey: YTWWOWVWYTXBME-UHFFFAOYSA-N.
| Molecular formula | C14H21ClFNO2S |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 1-ethyl-4-(2-fluoro-3-methylsulfonylphenyl)piperidine;hydrochloride |
| InChIKey | YTWWOWVWYTXBME-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)C2=C(C(=CC=C2)S(=O)(=O)C)F.Cl |
Computed by PubChem (NCBI)