cas: 68890-66-4 — see every product listed under this CAS number, including other names
Piroctone olamine 97% (CAS 68890-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 50mg, 100mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A903889-1mg |
| cas | 68890-66-4 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 50mg | 197.94 Pln | |
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A903889 |
2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one (CAS 68890-66-4) is a chemical compound with the molecular formula C16H30N2O3 and a molecular weight of 298.42 g/mol. IUPAC name: 2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one. InChIKey: BTSZTGGZJQFALU-UHFFFAOYSA-N.
| Molecular formula | C16H30N2O3 |
|---|---|
| Molecular weight | 298.42 g/mol |
| IUPAC name | 2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| InChIKey | BTSZTGGZJQFALU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=C1)CC(C)CC(C)(C)C)O.C(CO)N |
Computed by PubChem (NCBI)