cas: 68890-66-4 — see every product listed under this CAS number, including other names
Piroctone Olamine, >97.0%(HPLC)(T) (CAS 68890-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2178-1G |
| cas | 68890-66-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 280.61 Pln | |
| TCI | 5g | 890.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one (CAS 68890-66-4) is a chemical compound with the molecular formula C16H30N2O3 and a molecular weight of 298.42 g/mol. IUPAC name: 2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one. InChIKey: BTSZTGGZJQFALU-UHFFFAOYSA-N.
| Molecular formula | C16H30N2O3 |
|---|---|
| Molecular weight | 298.42 g/mol |
| IUPAC name | 2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| InChIKey | BTSZTGGZJQFALU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=C1)CC(C)CC(C)(C)C)O.C(CO)N |
Computed by PubChem (NCBI)