CAS 2140807-17-4 appears in our catalog under these names: Pomalidomide 4'–PEG2–acid, Pomalidomide-PEG2-CO2H/ 99.25% (existing batch purity), Pomalidomide-PEG2-COOH, Pomalidomide-PEG2-COOH 95%, POMALIDOMIDE-PEG2-CO2H,95%. Offered by: GLPBio, TargetMol, Iris Biotech, Ambeed, Sigma-Aldrich. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 200mg, 5g, 250mg.
3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoic acid (CAS 2140807-17-4) is a chemical compound with the molecular formula C20H23N3O8 and a molecular weight of 433.4 g/mol. IUPAC name: 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoic acid. InChIKey: NKISJPXMSOQWER-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O8 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | NKISJPXMSOQWER-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)