Pomalidomide-PEG4-C-COOH, 95%
cas: 2097938-44-6 — see every product listed under this CAS number, including other names
Pomalidomide-PEG4-C-COOH, 95% (CAS 2097938-44-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5mg, 10mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F808513-25MG |
| cas | 2097938-44-6 |
| size | 25mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 799.74 Pln | |
| Fluorochem | 50mg | 1309.97 Pln | |
| Fluorochem | 100mg | 2169.05 Pln | |
| Fluorochem | 250mg | 4241.23 Pln | |
| Fluorochem | 1g | 10921.17 Pln | |
| Ambeed | 100mg | 1555.19 Pln | |
| Ambeed | 250mg | 3079.31 Pln | |
| Ambeed | 1g | 7106.56 Pln | |
| Chemat | 5mg | 266.00 Pln | |
| Chemat | 10mg | 366.80 Pln | |
| Chemat | 25mg | 568.40 Pln | |
| Chemat | 50mg | 928.40 Pln | |
| Chemat | 100mg | 1533.20 Pln | |
| Chemat | 250mg | 3026.00 Pln | |
| Chemat | 1g | 7758.80 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 2097938-44-6) is a chemical compound with the molecular formula C23H29N3O10 and a molecular weight of 507.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: ZXAUDUQJSKVKNG-UHFFFAOYSA-N.
| Molecular formula | C23H29N3O10 |
|---|---|
| Molecular weight | 507.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | ZXAUDUQJSKVKNG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)