Products 2097938-44-6
CAS 2097938-44-6 appears in our catalog under these names: Pomalidomide-PEG4-C-COOH/ 96%, E3 Ligase Ligand–Linker Conjugates 1, Pomalidomide-PEG4-C-COOH, 95%, 95%, Pomalidomide-PEG4-C-COOH, 99.19%, Pomalidomide-PEG4-C-COOH, 95%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 2097938-44-6) is a chemical compound with the molecular formula C23H29N3O10 and a molecular weight of 507.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: ZXAUDUQJSKVKNG-UHFFFAOYSA-N.
| Molecular formula | C23H29N3O10 |
|---|---|
| Molecular weight | 507.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | ZXAUDUQJSKVKNG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)