cas: 1684443-00-2 — see every product listed under this CAS number, including other names
Potassium (1-(tert-butoxycarbonyl)pyrrolidin-2-yl)trifluoroborate 96% (CAS 1684443-00-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167228-250mg |
| cas | 1684443-00-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 3212.81 Pln | |
| Ambeed | 10g | 5804.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167228 |
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide (CAS 1684443-00-2) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide. InChIKey: JBFYSJLNBGRRCG-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boranuide |
| InChIKey | JBFYSJLNBGRRCG-UHFFFAOYSA-N |
| SMILES | [B-](C1CCCN1C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)