cas: 1430219-72-9 — see every product listed under this CAS number, including other names
Potassium (1-(tert-butoxycarbonyl)pyrrolidin-3-yl)trifluoroborate, 98%, 98% (CAS 1430219-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110E44-100mg |
| cas | 1430219-72-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1187.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide (CAS 1430219-72-9) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide. InChIKey: ZZTWIERFLVKQOX-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide |
| InChIKey | ZZTWIERFLVKQOX-UHFFFAOYSA-N |
| SMILES | [B-](C1CCN(C1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)