cas: 1430219-72-9 — see every product listed under this CAS number, including other names
Potassium {1-[(tert-butoxy)carbonyl]pyrrolidin-3-yl}trifluoroboranuide, 97% (CAS 1430219-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602473-100MG |
| cas | 1430219-72-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide (CAS 1430219-72-9) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide. InChIKey: ZZTWIERFLVKQOX-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide |
| InChIKey | ZZTWIERFLVKQOX-UHFFFAOYSA-N |
| SMILES | [B-](C1CCN(C1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)