cas: 1427323-42-9 — see every product listed under this CAS number, including other names
Potassium (4-acetamidophenyl)trifluoroboranuide 95+% (CAS 1427323-42-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A393087-250mg |
| cas | 1427323-42-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A393087 |
Potassium (4-acetamidophenyl)-trifluoroboranuide (CAS 1427323-42-9) is a chemical compound with the molecular formula C8H8BF3KNO and a molecular weight of 241.06 g/mol. IUPAC name: potassium (4-acetamidophenyl)-trifluoroboranuide. InChIKey: XICGZZIOZHTOEE-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3KNO |
|---|---|
| Molecular weight | 241.06 g/mol |
| IUPAC name | potassium (4-acetamidophenyl)-trifluoroboranuide |
| InChIKey | XICGZZIOZHTOEE-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)NC(=O)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)