CAS 1253046-38-6 is the registry number for Potassium benzamidomethyltrifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Potassium benzamidomethyl(trifluoro)boranuide (CAS 1253046-38-6) is a chemical compound with the molecular formula C8H8BF3KNO and a molecular weight of 241.06 g/mol. IUPAC name: potassium benzamidomethyl(trifluoro)boranuide. InChIKey: BRRMSHBHOSXPLX-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3KNO |
|---|---|
| Molecular weight | 241.06 g/mol |
| IUPAC name | potassium benzamidomethyl(trifluoro)boranuide |
| InChIKey | BRRMSHBHOSXPLX-UHFFFAOYSA-N |
| SMILES | [B-](CNC(=O)C1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)