cas: 585-09-1 — see every product listed under this CAS number, including other names
Potassium 2-hydroxysuccinate, ≥95%, ≥95% (CAS 585-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 5g, 25g, 2.5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OL8-100g |
| cas | 585-09-1 |
| size | 100g |
| availability | 7500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 218.00 Pln | |
| Chemat | 500g | 648.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 2.5kg | 1936.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Dipotassium;2-hydroxybutanedioate (CAS 585-09-1) is a chemical compound with the molecular formula C4H4K2O5 and a molecular weight of 210.27 g/mol. IUPAC name: dipotassium;2-hydroxybutanedioate. InChIKey: SVICABYXKQIXBM-UHFFFAOYSA-L.
| Molecular formula | C4H4K2O5 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | dipotassium;2-hydroxybutanedioate |
| InChIKey | SVICABYXKQIXBM-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)