CAS 585-09-1 appears in our catalog under these names: Butanedioic acid, hydroxy-, dipotassium salt, 95%, Potassium 2-hydroxysuccinate, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 100g, 500g, 2.5kg.
Dipotassium;2-hydroxybutanedioate (CAS 585-09-1) is a chemical compound with the molecular formula C4H4K2O5 and a molecular weight of 210.27 g/mol. IUPAC name: dipotassium;2-hydroxybutanedioate. InChIKey: SVICABYXKQIXBM-UHFFFAOYSA-L.
| Molecular formula | C4H4K2O5 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | dipotassium;2-hydroxybutanedioate |
| InChIKey | SVICABYXKQIXBM-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)