Potassium 5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate hydrate, 97%
cas: 143269-82-3 — see every product listed under this CAS number, including other names
Potassium 5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate hydrate, 97% (CAS 143269-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A562766-250mg |
| cas | 143269-82-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 2005.75 Pln | |
| Ambeed | 10g | 3173.88 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 1854.80 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 680.90 Pln | |
| BLDpharm | 5g | 1969.33 Pln | |
| BLDpharm | 10g | 3113.37 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate (CAS 143269-82-3) is a chemical compound with the molecular formula C5H4KN3O7 and a molecular weight of 257.20 g/mol. IUPAC name: potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate. InChIKey: JDMSALHSRWYAEM-UHFFFAOYSA-M.
| Molecular formula | C5H4KN3O7 |
|---|---|
| Molecular weight | 257.20 g/mol |
| IUPAC name | potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate |
| InChIKey | JDMSALHSRWYAEM-UHFFFAOYSA-M |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)[O-])[N+](=O)[O-].O.[K+] |
Computed by PubChem (NCBI)
Synonyms:
potassium 5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate hydrate, potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate, 5-Nitro-2,6-dioxo-1,2,3,4-tetrahydropyrimidine-4-carboxylic acid, 5-Nitroorotic acid potassium salt monohydrate, 98%, potassium5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylatehydrate