CAS 143269-82-3 is the registry number for Potassium 5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate hydrate, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate (CAS 143269-82-3) is a chemical compound with the molecular formula C5H4KN3O7 and a molecular weight of 257.20 g/mol. IUPAC name: potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate. InChIKey: JDMSALHSRWYAEM-UHFFFAOYSA-M.
| Molecular formula | C5H4KN3O7 |
|---|---|
| Molecular weight | 257.20 g/mol |
| IUPAC name | potassium;5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate;hydrate |
| InChIKey | JDMSALHSRWYAEM-UHFFFAOYSA-M |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)[O-])[N+](=O)[O-].O.[K+] |
Computed by PubChem (NCBI)