Potassium benzoate, 99%
cas: 582-25-2 — see every product listed under this CAS number, including other names
Potassium benzoate, 99% (CAS 582-25-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F094455-25G |
| cas | 582-25-2 |
| size | 25g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 107.27 Pln | |
| Fluorochem | 500g | 206.20 Pln | |
| Fluorochem | 1kg | 351.98 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 164.56 Pln | |
| Ambeed | 500g | 420.44 Pln | |
| Ambeed | 1kg | 654.06 Pln | |
| BLDpharm | 25g | 125.54 Pln | |
| BLDpharm | 100g | 203.29 Pln | |
| BLDpharm | 500g | 219.95 Pln | |
| BLDpharm | 1kg | 247.72 Pln |
properties
| purity | 99% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Potassium benzoate (CAS 582-25-2) is a chemical compound with the molecular formula C7H5KO2 and a molecular weight of 160.21 g/mol. IUPAC name: potassium benzoate. InChIKey: XAEFZNCEHLXOMS-UHFFFAOYSA-M.
| Molecular formula | C7H5KO2 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | potassium benzoate |
| InChIKey | XAEFZNCEHLXOMS-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)