CAS 58765-11-0 is the registry number for 4-Hydroxybenzaldehyde potassium salt, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Potassium 4-formylphenolate (CAS 58765-11-0) is a chemical compound with the molecular formula C7H5KO2 and a molecular weight of 160.21 g/mol. IUPAC name: potassium 4-formylphenolate. InChIKey: YBMLSFPMJMAFOD-UHFFFAOYSA-M.
| Molecular formula | C7H5KO2 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | potassium 4-formylphenolate |
| InChIKey | YBMLSFPMJMAFOD-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C=O)[O-].[K+] |
Computed by PubChem (NCBI)