cas: 33494-80-3 — see every product listed under this CAS number, including other names
Potassium di-tert-butyl phosphate, 98%, 98% (CAS 33494-80-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146IF-1g |
| cas | 33494-80-3 |
| size | 1g |
| availability | 2226g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 232.40 Pln | |
| Chemat | 250g | 482.00 Pln | |
| Chemat | 500g | 974.40 Pln | |
| Chemat | 1kg | 1869.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
CAS 33494-80-3 identifies a chemical compound with the molecular formula C8H19KO4P and a molecular weight of 249.31 g/mol. InChIKey: SZCKQRFZBSIRLK-UHFFFAOYSA-N.
| Molecular formula | C8H19KO4P |
|---|---|
| Molecular weight | 249.31 g/mol |
| InChIKey | SZCKQRFZBSIRLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(O)OC(C)(C)C.[K] |
Computed by PubChem (NCBI)