CAS 33494-80-3 appears in our catalog under these names: Potassium di-tert-butylphosphate, 97%, Potassium di–tert–butyl phosphate, Potassium Di-tert-butyl Phosphate, >95.0%(qNMR), Potassium di-tert-butyl phosphate 98%, FRENCH-SEL DE POTASSIUM DI-TERT-BUTYLPH&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 10g, 1000g, 250g.
CAS 33494-80-3 identifies a chemical compound with the molecular formula C8H19KO4P and a molecular weight of 249.31 g/mol. InChIKey: SZCKQRFZBSIRLK-UHFFFAOYSA-N.
| Molecular formula | C8H19KO4P |
|---|---|
| Molecular weight | 249.31 g/mol |
| InChIKey | SZCKQRFZBSIRLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(O)OC(C)(C)C.[K] |
Computed by PubChem (NCBI)