cas: 1510778-85-4 — see every product listed under this CAS number, including other names
Potassium trifluoro(2,2,2-trifluoroethyl)borate, 97%, 97% (CAS 1510778-85-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXUC-50mg |
| cas | 1510778-85-4 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 88.40 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1878.80 Pln | |
| Chemat | 10g | 3150.80 Pln | |
| Chemat | 25g | 6242.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Potassium trifluoro(2,2,2-trifluoroethyl)boranuide (CAS 1510778-85-4) is a chemical compound with the molecular formula C2H2BF6K and a molecular weight of 189.94 g/mol. IUPAC name: potassium trifluoro(2,2,2-trifluoroethyl)boranuide. InChIKey: VRCXHAGAWUNMMJ-UHFFFAOYSA-N.
| Molecular formula | C2H2BF6K |
|---|---|
| Molecular weight | 189.94 g/mol |
| IUPAC name | potassium trifluoro(2,2,2-trifluoroethyl)boranuide |
| InChIKey | VRCXHAGAWUNMMJ-UHFFFAOYSA-N |
| SMILES | [B-](CC(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)