CAS 1510778-85-4 appears in our catalog under these names: Potassium 2,2,2-trifluoroethane-2-trifluoroborate, 95%, Potassium Trifluoro(2,2,2-trifluoroethyl)borate, Potassium trifluoro(2,2,2-trifluoroethyl)borate 95%, Potassium trifluoro(2,2,2-trifluoroethyl)borate, 97%, 97%, Potassium trifluoro(2,2,2-trifluoroethyl)borate, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 2g, 50mg, 10g, 25g.
Potassium trifluoro(2,2,2-trifluoroethyl)boranuide (CAS 1510778-85-4) is a chemical compound with the molecular formula C2H2BF6K and a molecular weight of 189.94 g/mol. IUPAC name: potassium trifluoro(2,2,2-trifluoroethyl)boranuide. InChIKey: VRCXHAGAWUNMMJ-UHFFFAOYSA-N.
| Molecular formula | C2H2BF6K |
|---|---|
| Molecular weight | 189.94 g/mol |
| IUPAC name | potassium trifluoro(2,2,2-trifluoroethyl)boranuide |
| InChIKey | VRCXHAGAWUNMMJ-UHFFFAOYSA-N |
| SMILES | [B-](CC(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)