cas: 42298-15-7 — see every product listed under this CAS number, including other names
Potassium trifluoro(trifluoromethyl)borate 98% (CAS 42298-15-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485797-250mg |
| cas | 42298-15-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1304.88 Pln | |
| Ambeed | 25g | 3780.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485797 |
Potassium trifluoro(trifluoromethyl)boranuide (CAS 42298-15-7) is a chemical compound with the molecular formula CBF6K and a molecular weight of 175.91 g/mol. IUPAC name: potassium trifluoro(trifluoromethyl)boranuide. InChIKey: UOGBGCVSVMQVBR-UHFFFAOYSA-N.
| Molecular formula | CBF6K |
|---|---|
| Molecular weight | 175.91 g/mol |
| IUPAC name | potassium trifluoro(trifluoromethyl)boranuide |
| InChIKey | UOGBGCVSVMQVBR-UHFFFAOYSA-N |
| SMILES | [B-](C(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)